C16H21ClN4O3S — CID 74234130
1-[2-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-ethylsulfonylethyl)urea (PubChem CID 74234130) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-ethylsulfonylethyl)urea.
| Compound Name | 1-[2-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-ethylsulfonylethyl)urea |
|---|---|
| PubChem CID | 74234130 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-ethylsulfonylethyl)urea |
| SMILES | CCS(=O)(=O)CCNC(=O)Nc1cc(C)nn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4O3S/c1-3-25(23,24)8-7-18-16(22)19-15-9-12(2)20-21(15)11-13-5-4-6-14(17)10-13/h4-6,9-10H,3,7-8,11H2,1-2H3,(H2,18,19,22) |
| InChIKey | NMUIENCTXDOPEU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |