C17H21N9O — CID 74234278
1-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea (PubChem CID 74234278) has the molecular formula C17H21N9O and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea.
| Compound Name | 1-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 74234278 |
| Molecular Formula | C17H21N9O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
| SMILES | Cc1ccc(-c2nnn(C)n2)cc1NC(=O)NCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C17H21N9O/c1-11-6-7-12(16-22-24-25(2)23-16)9-13(11)19-17(27)18-10-15-21-20-14-5-3-4-8-26(14)15/h6-7,9H,3-5,8,10H2,1-2H3,(H2,18,19,27) |
| InChIKey | LIRREZDRZMVGBJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |