C16H20N6O — CID 74243943
4-methyl-N-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 74243943) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-methyl-N-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-methyl-N-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 74243943 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-methyl-N-[2-methyl-5-(2-methyltetrazol-5-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC1=CCN(C(=O)Nc2cc(-c3nnn(C)n3)ccc2C)CC1 |
| InChI | InChI=1S/C16H20N6O/c1-11-6-8-22(9-7-11)16(23)17-14-10-13(5-4-12(14)2)15-18-20-21(3)19-15/h4-6,10H,7-9H2,1-3H3,(H,17,23) |
| InChIKey | SMOHUNFZHQBRKV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|