C20H24F2N4O — CID 74237829
N-cyclohexyl-2-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]acetamide (PubChem CID 74237829) has the molecular formula C20H24F2N4O and a molecular weight of 374.44 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 74237829 |
| Molecular Formula | C20H24F2N4O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-cyclohexyl-2-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]acetamide |
| SMILES | O=C(CN1CCc2nc(-c3ccc(F)cc3F)[nH]c2C1)NC1CCCCC1 |
| InChI | InChI=1S/C20H24F2N4O/c21-13-6-7-15(16(22)10-13)20-24-17-8-9-26(11-18(17)25-20)12-19(27)23-14-4-2-1-3-5-14/h6-7,10,14H,1-5,8-9,11-12H2,(H,23,27)(H,24,25) |
| InChIKey | KDLQLQWIYZNNNB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |