C20H23F2N3O2 — CID 72856608
(2R)-2-cyclohexyl-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxyethanone (PubChem CID 72856608) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxyethanone.
| Compound Name | (2R)-2-cyclohexyl-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 72856608 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2R)-2-cyclohexyl-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxyethanone |
| SMILES | O=C([C@H](O)C1CCCCC1)N1CCc2nc(-c3ccc(F)cc3F)[nH]c2C1 |
| InChI | InChI=1S/C20H23F2N3O2/c21-13-6-7-14(15(22)10-13)19-23-16-8-9-25(11-17(16)24-19)20(27)18(26)12-4-2-1-3-5-12/h6-7,10,12,18,26H,1-5,8-9,11H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | BEIVCKTWTOMXHE-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |