C20H24F2N4O — CID 72855340
2-[cyclopentyl(methyl)amino]-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone (PubChem CID 72855340) has the molecular formula C20H24F2N4O and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[cyclopentyl(methyl)amino]-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone.
| Compound Name | 2-[cyclopentyl(methyl)amino]-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 72855340 |
| Molecular Formula | C20H24F2N4O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[cyclopentyl(methyl)amino]-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone |
| SMILES | CN(CC(=O)N1CCc2nc(-c3ccc(F)cc3F)[nH]c2C1)C1CCCC1 |
| InChI | InChI=1S/C20H24F2N4O/c1-25(14-4-2-3-5-14)12-19(27)26-9-8-17-18(11-26)24-20(23-17)15-7-6-13(21)10-16(15)22/h6-7,10,14H,2-5,8-9,11-12H2,1H3,(H,23,24) |
| InChIKey | VHLDOOYWYMBRCS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |