C17H19F2N3O2 — CID 97436187
(2R)-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxy-3-methylbutan-1-one (PubChem CID 97436187) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is (2R)-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxy-3-methylbutan-1-one.
| Compound Name | (2R)-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxy-3-methylbutan-1-one |
|---|---|
| PubChem CID | 97436187 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R)-1-[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-hydroxy-3-methylbutan-1-one |
| SMILES | CC(C)[C@@H](O)C(=O)N1CCc2nc(-c3ccc(F)cc3F)[nH]c2C1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-9(2)15(23)17(24)22-6-5-13-14(8-22)21-16(20-13)11-4-3-10(18)7-12(11)19/h3-4,7,9,15,23H,5-6,8H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | KEVRRGJWBPJFOT-OAHLLOKOSA-N |
| XLogP | 2.26 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |