C19H21F2N5O — CID 74241012
2-[4-[[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-methylpyrazol-1-yl]ethanol (PubChem CID 74241012) has the molecular formula C19H21F2N5O and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[4-[[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-methylpyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-methylpyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 74241012 |
| Molecular Formula | C19H21F2N5O |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-[4-[[2-(2,4-difluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-3-methylpyrazol-1-yl]ethanol |
| SMILES | Cc1nn(CCO)cc1CN1CCc2nc(-c3ccc(F)cc3F)[nH]c2C1 |
| InChI | InChI=1S/C19H21F2N5O/c1-12-13(10-26(24-12)6-7-27)9-25-5-4-17-18(11-25)23-19(22-17)15-3-2-14(20)8-16(15)21/h2-3,8,10,27H,4-7,9,11H2,1H3,(H,22,23) |
| InChIKey | MALDSTRUFODFPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |