C19H23FN2O2 — CID 74237938
N-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-5,6-dimethylpyridine-3-carboxamide (PubChem CID 74237938) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-5,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-5,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 74237938 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-5,6-dimethylpyridine-3-carboxamide |
| SMILES | COCCCN(Cc1ccc(F)cc1)C(=O)c1cnc(C)c(C)c1 |
| InChI | InChI=1S/C19H23FN2O2/c1-14-11-17(12-21-15(14)2)19(23)22(9-4-10-24-3)13-16-5-7-18(20)8-6-16/h5-8,11-12H,4,9-10,13H2,1-3H3 |
| InChIKey | QWVULQDKDOTHHZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|