C14H13FN2O4S — CID 74238408
2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one (PubChem CID 74238408) has the molecular formula C14H13FN2O4S and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 74238408 |
| Molecular Formula | C14H13FN2O4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one |
| SMILES | O=C(c1cc(=O)c2cccc(F)c2[nH]1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H13FN2O4S/c15-10-3-1-2-9-12(18)8-11(16-13(9)10)14(19)17-4-6-22(20,21)7-5-17/h1-3,8H,4-7H2,(H,16,18) |
| InChIKey | URIJWVFSJFGHMW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |