About 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one
2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one (PubChem CID 74238408) has the molecular formula C14H13FN2O4S
and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one |
| PubChem CID | 74238408 |
| Molecular Formula | C14H13FN2O4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one |
| SMILES | O=C(c1cc(=O)c2cccc(F)c2[nH]1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H13FN2O4S/c15-10-3-1-2-9-12(18)8-11(16-13(9)10)14(19)17-4-6-22(20,21)7-5-17/h1-3,8H,4-7H2,(H,16,18) |
| InChIKey | URIJWVFSJFGHMW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one?
The IUPAC name of 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one (CID 74238408) is 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one.
What is the SMILES notation for 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one?
The canonical SMILES for 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one is O=C(c1cc(=O)c2cccc(F)c2[nH]1)N1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one?
The InChIKey is URIJWVFSJFGHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O4S/c15-10-3-1-2-9-12(18)8-11(16-13(9)10)14(19)17-4-6-22(20,21)7-5-17/h1-3,8H,4-7H2,(H,16,18).
What are the key properties of 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one?
2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one has a molecular weight of 324.33 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-8-fluoro-1H-quinolin-4-one is sourced from PubChem (CID 74238408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).