About 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one
2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one (PubChem CID 138381000) has the molecular formula C17H17FN2O4
and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one |
| PubChem CID | 138381000 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one |
| SMILES | O=C(c1cc(=O)c2cccc(F)c2[nH]1)N1CC2C(C1)C2(CO)CO |
| InChI | InChI=1S/C17H17FN2O4/c18-12-3-1-2-9-14(23)4-13(19-15(9)12)16(24)20-5-10-11(6-20)17(10,7-21)8-22/h1-4,10-11,21-22H,5-8H2,(H,19,23) |
| InChIKey | DWDZUJJASRXQAO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one?
The IUPAC name of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one (CID 138381000) is 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one.
What is the SMILES notation for 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one?
The canonical SMILES for 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one is O=C(c1cc(=O)c2cccc(F)c2[nH]1)N1CC2C(C1)C2(CO)CO.
What is the InChIKey of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one?
The InChIKey is DWDZUJJASRXQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2O4/c18-12-3-1-2-9-14(23)4-13(19-15(9)12)16(24)20-5-10-11(6-20)17(10,7-21)8-22/h1-4,10-11,21-22H,5-8H2,(H,19,23).
What are the key properties of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one?
2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one has a molecular weight of 332.33 g/mol, XLogP of 0.34, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]-8-fluoro-1H-quinolin-4-one is sourced from PubChem (CID 138381000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).