C10H14N6+2 — CID 7426676
[3-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide (PubChem CID 7426676) has the molecular formula C10H14N6+2 and a molecular weight of 218.26 g/mol. Its IUPAC name is [3-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide.
| Compound Name | [3-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide |
|---|---|
| PubChem CID | 7426676 |
| Molecular Formula | C10H14N6+2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [3-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]cyanamide |
| SMILES | N#CNC1=[NH+]C[NH+](Cc2cccnc2)CN1 |
| InChI | InChI=1S/C10H12N6/c11-6-13-10-14-7-16(8-15-10)5-9-2-1-3-12-4-9/h1-4H,5,7-8H2,(H2,13,14,15)/p+2 |
| InChIKey | DVHLQUZHXXCFPB-UHFFFAOYSA-P |
| XLogP | -3.51 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|