C16H26N3O+ — CID 7428250
(3S)-1-[(4-propan-2-ylphenyl)methyl]piperidin-1-ium-3-carbohydrazide (PubChem CID 7428250) has the molecular formula C16H26N3O+ and a molecular weight of 276.40 g/mol. Its IUPAC name is (3S)-1-[(4-propan-2-ylphenyl)methyl]piperidin-1-ium-3-carbohydrazide.
| Compound Name | (3S)-1-[(4-propan-2-ylphenyl)methyl]piperidin-1-ium-3-carbohydrazide |
|---|---|
| PubChem CID | 7428250 |
| Molecular Formula | C16H26N3O+ |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (3S)-1-[(4-propan-2-ylphenyl)methyl]piperidin-1-ium-3-carbohydrazide |
| SMILES | CC(C)c1ccc(C[NH+]2CCC[C@H](C(=O)NN)C2)cc1 |
| InChI | InChI=1S/C16H25N3O/c1-12(2)14-7-5-13(6-8-14)10-19-9-3-4-15(11-19)16(20)18-17/h5-8,12,15H,3-4,9-11,17H2,1-2H3,(H,18,20)/p+1/t15-/m0/s1 |
| InChIKey | XUFLNHYJWCEETJ-HNNXBMFYSA-O |
| XLogP | 0.59 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|