C19H35N4O2S+ — CID 7430661
2-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-hexanoylamino]ethyl-diethylazanium (PubChem CID 7430661) has the molecular formula C19H35N4O2S+ and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-hexanoylamino]ethyl-diethylazanium.
| Compound Name | 2-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-hexanoylamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7430661 |
| Molecular Formula | C19H35N4O2S+ |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-hexanoylamino]ethyl-diethylazanium |
| SMILES | CCCCCC(=O)N(CC[NH+](CC)CC)CC(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C19H34N4O2S/c1-6-9-10-11-18(25)23(13-12-22(7-2)8-3)14-17(24)21-19-20-15(4)16(5)26-19/h6-14H2,1-5H3,(H,20,21,24)/p+1 |
| InChIKey | WGFHDCWQPKKMAW-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|