C21H37N4O3S+ — CID 7271312
N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ium-4-ylpropyl)heptanamide (PubChem CID 7271312) has the molecular formula C21H37N4O3S+ and a molecular weight of 425.62 g/mol. Its IUPAC name is N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ium-4-ylpropyl)heptanamide.
| Compound Name | N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ium-4-ylpropyl)heptanamide |
|---|---|
| PubChem CID | 7271312 |
| Molecular Formula | C21H37N4O3S+ |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ium-4-ylpropyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCC[NH+]1CCOCC1)CC(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C21H36N4O3S/c1-4-5-6-7-9-20(27)25(11-8-10-24-12-14-28-15-13-24)16-19(26)23-21-22-17(2)18(3)29-21/h4-16H2,1-3H3,(H,22,23,26)/p+1 |
| InChIKey | AMQYWAIYCOIVEO-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|