C22H15NO7-2 — CID 7431131
4-[4-[(2-phenoxyacetyl)amino]phenoxy]phthalate (PubChem CID 7431131) has the molecular formula C22H15NO7-2 and a molecular weight of 405.36 g/mol. Its IUPAC name is 4-[4-[(2-phenoxyacetyl)amino]phenoxy]phthalate.
| Compound Name | 4-[4-[(2-phenoxyacetyl)amino]phenoxy]phthalate |
|---|---|
| PubChem CID | 7431131 |
| Molecular Formula | C22H15NO7-2 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-[4-[(2-phenoxyacetyl)amino]phenoxy]phthalate |
| SMILES | O=C(COc1ccccc1)Nc1ccc(Oc2ccc(C(=O)[O-])c(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H17NO7/c24-20(13-29-15-4-2-1-3-5-15)23-14-6-8-16(9-7-14)30-17-10-11-18(21(25)26)19(12-17)22(27)28/h1-12H,13H2,(H,23,24)(H,25,26)(H,27,28)/p-2 |
| InChIKey | IZBVCBWBKOJQFM-UHFFFAOYSA-L |
| XLogP | 1.22 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |