C8H16N+ — CID 7431640
(4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-1-ium (PubChem CID 7431640) has the molecular formula C8H16N+ and a molecular weight of 126.22 g/mol. Its IUPAC name is (4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-1-ium.
| Compound Name | (4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-1-ium |
|---|---|
| PubChem CID | 7431640 |
| Molecular Formula | C8H16N+ |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.13 |
| IUPAC Name | (4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-1-ium |
| SMILES | C1C[NH2+][C@@H]2CCC[C@@H]2C1 |
| InChI | InChI=1S/C8H15N/c1-3-7-4-2-6-9-8(7)5-1/h7-9H,1-6H2/p+1/t7-,8-/m1/s1 |
| InChIKey | CJNWCWVQGCSQRA-HTQZYQBOSA-O |
| XLogP | 0.51 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |