C15H13ClFN3O — CID 74335094
N-[1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide (PubChem CID 74335094) has the molecular formula C15H13ClFN3O and a molecular weight of 305.74 g/mol. Its IUPAC name is N-[1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 74335094 |
| Molecular Formula | C15H13ClFN3O |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-[1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(C#N)n1C)c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H13ClFN3O/c1-9(14-11(16)4-3-5-12(14)17)19-15(21)13-7-6-10(8-18)20(13)2/h3-7,9H,1-2H3,(H,19,21) |
| InChIKey | OVRPUVGBRNDNAS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |