C21H18FN3O — CID 154858264
N-[1-(4-cyanophenyl)ethyl]-5-(4-fluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 154858264) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)ethyl]-5-(4-fluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-(4-cyanophenyl)ethyl]-5-(4-fluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154858264 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[1-(4-cyanophenyl)ethyl]-5-(4-fluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(-c2ccc(F)cc2)n1C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H18FN3O/c1-14(16-5-3-15(13-23)4-6-16)24-21(26)20-12-11-19(25(20)2)17-7-9-18(22)10-8-17/h3-12,14H,1-2H3,(H,24,26) |
| InChIKey | NFMBUACNDRASIS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |