C20H22FN6O2+ — CID 7436483
N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide (PubChem CID 7436483) has the molecular formula C20H22FN6O2+ and a molecular weight of 397.43 g/mol. Its IUPAC name is N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7436483 |
| Molecular Formula | C20H22FN6O2+ |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(C[NH+]1CCC(n2nnc3cc(F)ccc32)CC1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21FN6O2/c21-15-6-7-18-17(12-15)22-25-27(18)16-8-10-26(11-9-16)13-19(28)23-24-20(29)14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2,(H,23,28)(H,24,29)/p+1 |
| InChIKey | BKNFSJJUTOIKFF-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|