C22H27N6O3+ — CID 7436495
4-methoxy-N'-[2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide (PubChem CID 7436495) has the molecular formula C22H27N6O3+ and a molecular weight of 423.50 g/mol. Its IUPAC name is 4-methoxy-N'-[2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7436495 |
| Molecular Formula | C22H27N6O3+ |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-methoxy-N'-[2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-ium-1-yl]acetyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)C[NH+]2CCC(n3nnc4cc(C)ccc43)CC2)cc1 |
| InChI | InChI=1S/C22H26N6O3/c1-15-3-8-20-19(13-15)23-26-28(20)17-9-11-27(12-10-17)14-21(29)24-25-22(30)16-4-6-18(31-2)7-5-16/h3-8,13,17H,9-12,14H2,1-2H3,(H,24,29)(H,25,30)/p+1 |
| InChIKey | WAZQYCDVKFKYEY-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|