C11H11BrN3O5P — CID 74378420
1-[(7-bromo-2,3-dioxoquinoxalin-5-yl)methylamino]ethylphosphonic acid (PubChem CID 74378420) has the molecular formula C11H11BrN3O5P and a molecular weight of 376.10 g/mol. Its IUPAC name is 1-[(7-bromo-2,3-dioxoquinoxalin-5-yl)methylamino]ethylphosphonic acid.
| Compound Name | 1-[(7-bromo-2,3-dioxoquinoxalin-5-yl)methylamino]ethylphosphonic acid |
|---|---|
| PubChem CID | 74378420 |
| Molecular Formula | C11H11BrN3O5P |
| Molecular Weight | 376.10 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 1-[(7-bromo-2,3-dioxoquinoxalin-5-yl)methylamino]ethylphosphonic acid |
| SMILES | CC(NCc1cc(Br)cc2c1=NC(=O)C(=O)N=2)P(=O)(O)O |
| InChI | InChI=1S/C11H11BrN3O5P/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8/h2-3,5,13H,4H2,1H3,(H2,18,19,20) |
| InChIKey | UKZZHTMFTBYVRX-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.10 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|