C13H22N5O2+ — CID 74441112
7-[2-(diethylamino)ethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74441112) has the molecular formula C13H22N5O2+ and a molecular weight of 280.35 g/mol. Its IUPAC name is 7-[2-(diethylamino)ethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-(diethylamino)ethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74441112 |
| Molecular Formula | C13H22N5O2+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 7-[2-(diethylamino)ethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCN(CC)CC[N+]1=CN=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H22N5O2/c1-5-17(6-2)7-8-18-9-14-11-10(18)12(19)16(4)13(20)15(11)3/h9-10H,5-8H2,1-4H3/q+1 |
| InChIKey | FHBVZEHALMPXSA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|