C11H11F3O2 — CID 744419
(4S)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one (PubChem CID 744419) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is (4S)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one.
| Compound Name | (4S)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one |
|---|---|
| PubChem CID | 744419 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (4S)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one |
| SMILES | CC(=O)C[C@](O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-8(15)7-10(16,11(12,13)14)9-5-3-2-4-6-9/h2-6,16H,7H2,1H3/t10-/m0/s1 |
| InChIKey | VJAXMKZOQDXQPI-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |