C13H18Cl2NO+ — CID 7445680
2,4-dichloro-6-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]phenol (PubChem CID 7445680) has the molecular formula C13H18Cl2NO+ and a molecular weight of 275.20 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 7445680 |
| Molecular Formula | C13H18Cl2NO+ |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2,4-dichloro-6-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]phenol |
| SMILES | C[C@@H]1CCC[NH+](Cc2cc(Cl)cc(Cl)c2O)C1 |
| InChI | InChI=1S/C13H17Cl2NO/c1-9-3-2-4-16(7-9)8-10-5-11(14)6-12(15)13(10)17/h5-6,9,17H,2-4,7-8H2,1H3/p+1/t9-/m1/s1 |
| InChIKey | RISPVDIVGKGSIN-SECBINFHSA-O |
| XLogP | 2.51 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|