C20H25BrNO2+ — CID 7454835
(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl-cyclopentylazanium (PubChem CID 7454835) has the molecular formula C20H25BrNO2+ and a molecular weight of 391.33 g/mol. Its IUPAC name is (2-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl-cyclopentylazanium.
| Compound Name | (2-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl-cyclopentylazanium |
|---|---|
| PubChem CID | 7454835 |
| Molecular Formula | C20H25BrNO2+ |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (2-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl-cyclopentylazanium |
| SMILES | COc1cc(C[NH2+]C2CCCC2)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H24BrNO2/c1-23-19-11-16(13-22-17-9-5-6-10-17)18(21)12-20(19)24-14-15-7-3-2-4-8-15/h2-4,7-8,11-12,17,22H,5-6,9-10,13-14H2,1H3/p+1 |
| InChIKey | BFKAICFFJPFIJW-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |