C16H26N7O3+ — CID 74580994
2-[8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide (PubChem CID 74580994) has the molecular formula C16H26N7O3+ and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | 2-[8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 74580994 |
| Molecular Formula | C16H26N7O3+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-[8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CCN1CCN(CC2=[N+](CC(N)=O)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C16H25N7O3/c1-4-21-5-7-22(8-6-21)10-12-18-14-13(23(12)9-11(17)24)15(25)20(3)16(26)19(14)2/h13H,4-10H2,1-3H3,(H-,17,24)/p+1 |
| InChIKey | PCCWDMVLCOHPLL-UHFFFAOYSA-O |
| XLogP | -2.18 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|