C20H22NO3- — CID 7459794
(2R)-2-[(2,2-diphenylacetyl)amino]hexanoate (PubChem CID 7459794) has the molecular formula C20H22NO3- and a molecular weight of 324.40 g/mol. Its IUPAC name is (2R)-2-[(2,2-diphenylacetyl)amino]hexanoate.
| Compound Name | (2R)-2-[(2,2-diphenylacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 7459794 |
| Molecular Formula | C20H22NO3- |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2R)-2-[(2,2-diphenylacetyl)amino]hexanoate |
| SMILES | CCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C20H23NO3/c1-2-3-14-17(20(23)24)21-19(22)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-18H,2-3,14H2,1H3,(H,21,22)(H,23,24)/p-1/t17-/m1/s1 |
| InChIKey | MMQAONXFYQPOJA-QGZVFWFLSA-M |
| XLogP | 2.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |