C14H24IN2O4- — CID 19939712
2-[2-[(2-iodoacetyl)amino]hexanoylamino]hexanoate (PubChem CID 19939712) has the molecular formula C14H24IN2O4- and a molecular weight of 411.26 g/mol. Its IUPAC name is 2-[2-[(2-iodoacetyl)amino]hexanoylamino]hexanoate.
| Compound Name | 2-[2-[(2-iodoacetyl)amino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 19939712 |
| Molecular Formula | C14H24IN2O4- |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-[2-[(2-iodoacetyl)amino]hexanoylamino]hexanoate |
| SMILES | CCCCC(NC(=O)C(CCCC)NC(=O)CI)C(=O)[O-] |
| InChI | InChI=1S/C14H25IN2O4/c1-3-5-7-10(16-12(18)9-15)13(19)17-11(14(20)21)8-6-4-2/h10-11H,3-9H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)/p-1 |
| InChIKey | KGIQCMUPBSOGII-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|