C11H16N5O3+ — CID 74598387
2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N,N-dimethylacetamide (PubChem CID 74598387) has the molecular formula C11H16N5O3+ and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 74598387 |
| Molecular Formula | C11H16N5O3+ |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C11H16N5O3/c1-13(2)7(17)5-16-10(18)8-9(12-6-14(8)3)15(4)11(16)19/h6,8H,5H2,1-4H3/q+1 |
| InChIKey | ULBYOXRFVNFNMP-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|