C12H18N7O3+ — CID 7461097
3-[[4-amino-6-(furan-2-ylmethylamino)-5-nitropyrimidin-2-yl]amino]propylazanium (PubChem CID 7461097) has the molecular formula C12H18N7O3+ and a molecular weight of 308.32 g/mol. Its IUPAC name is 3-[[4-amino-6-(furan-2-ylmethylamino)-5-nitropyrimidin-2-yl]amino]propylazanium.
| Compound Name | 3-[[4-amino-6-(furan-2-ylmethylamino)-5-nitropyrimidin-2-yl]amino]propylazanium |
|---|---|
| PubChem CID | 7461097 |
| Molecular Formula | C12H18N7O3+ |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-[[4-amino-6-(furan-2-ylmethylamino)-5-nitropyrimidin-2-yl]amino]propylazanium |
| SMILES | Nc1nc(NCCC[NH3+])nc(NCc2ccco2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N7O3/c13-4-2-5-15-12-17-10(14)9(19(20)21)11(18-12)16-7-8-3-1-6-22-8/h1,3,6H,2,4-5,7,13H2,(H4,14,15,16,17,18)/p+1 |
| InChIKey | AOIGGSBAIMFUDV-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 159.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|