C12H21N4O3+ — CID 7461898
dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]propyl]azanium (PubChem CID 7461898) has the molecular formula C12H21N4O3+ and a molecular weight of 269.32 g/mol. Its IUPAC name is dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]propyl]azanium.
| Compound Name | dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 7461898 |
| Molecular Formula | C12H21N4O3+ |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]propyl]azanium |
| SMILES | CC/C(=N\CCC[NH+](C)C)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H20N4O3/c1-4-8(13-6-5-7-16(2)3)9-10(17)14-12(19)15-11(9)18/h9H,4-7H2,1-3H3,(H2,14,15,17,18,19)/p+1/b13-8+ |
| InChIKey | FEFHUBWWYUAKLF-MDWZMJQESA-O |
| XLogP | -1.65 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|