C16H27N4O3+ — CID 7462013
diethyl-[3-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium (PubChem CID 7462013) has the molecular formula C16H27N4O3+ and a molecular weight of 323.42 g/mol. Its IUPAC name is diethyl-[3-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium.
| Compound Name | diethyl-[3-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 7462013 |
| Molecular Formula | C16H27N4O3+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | diethyl-[3-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium |
| SMILES | C=CCN1C(=O)NC(=O)C(/C(C)=N/CCC[NH+](CC)CC)C1=O |
| InChI | InChI=1S/C16H26N4O3/c1-5-10-20-15(22)13(14(21)18-16(20)23)12(4)17-9-8-11-19(6-2)7-3/h5,13H,1,6-11H2,2-4H3,(H,18,21,23)/p+1/b17-12+ |
| InChIKey | ANKQWSVYHXXLNU-SFQUDFHCSA-O |
| XLogP | -0.36 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|