C20H27ClNO3+ — CID 7462394
[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(2S)-1-hydroxybutan-2-yl]azanium (PubChem CID 7462394) has the molecular formula C20H27ClNO3+ and a molecular weight of 364.89 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(2S)-1-hydroxybutan-2-yl]azanium.
| Compound Name | [4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(2S)-1-hydroxybutan-2-yl]azanium |
|---|---|
| PubChem CID | 7462394 |
| Molecular Formula | C20H27ClNO3+ |
| Molecular Weight | 364.89 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(2S)-1-hydroxybutan-2-yl]azanium |
| SMILES | CCOc1cc(C[NH2+][C@@H](CC)CO)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H26ClNO3/c1-3-17(13-23)22-12-15-9-10-19(20(11-15)24-4-2)25-14-16-7-5-6-8-18(16)21/h5-11,17,22-23H,3-4,12-14H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | DNKBFCZLBROFSE-KRWDZBQOSA-O |
| XLogP | 3.15 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.89 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |