C21H27ClNO3+ — CID 7263188
[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 7263188) has the molecular formula C21H27ClNO3+ and a molecular weight of 376.90 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7263188 |
| Molecular Formula | C21H27ClNO3+ |
| Molecular Weight | 376.90 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | CCOc1cc(C[NH2+]C[C@H]2CCCO2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H26ClNO3/c1-2-24-21-12-16(13-23-14-18-7-5-11-25-18)9-10-20(21)26-15-17-6-3-4-8-19(17)22/h3-4,6,8-10,12,18,23H,2,5,7,11,13-15H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | ASPJIYNHLTZHRM-GOSISDBHSA-O |
| XLogP | 3.56 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |