C21H28NO3+ — CID 7458193
[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 7458193) has the molecular formula C21H28NO3+ and a molecular weight of 342.46 g/mol. Its IUPAC name is [3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7458193 |
| Molecular Formula | C21H28NO3+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | [3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | COc1cc(C[NH2+]C[C@H]2CCCO2)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C21H27NO3/c1-16-5-3-6-18(11-16)15-25-20-9-8-17(12-21(20)23-2)13-22-14-19-7-4-10-24-19/h3,5-6,8-9,11-12,19,22H,4,7,10,13-15H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | SIHMHIXGRSYBON-LJQANCHMSA-O |
| XLogP | 2.83 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |