C19H19BrN2O2S — CID 74675313
1-[3-(4-bromophenyl)-2-thiophen-2-ylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 74675313) has the molecular formula C19H19BrN2O2S and a molecular weight of 419.34 g/mol. Its IUPAC name is 1-[3-(4-bromophenyl)-2-thiophen-2-ylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(4-bromophenyl)-2-thiophen-2-ylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74675313 |
| Molecular Formula | C19H19BrN2O2S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 1-[3-(4-bromophenyl)-2-thiophen-2-ylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(=Cc2ccc(Br)cc2)c2cccs2)CC1 |
| InChI | InChI=1S/C19H19BrN2O2S/c20-15-5-3-13(4-6-15)12-16(17-2-1-11-25-17)19(24)22-9-7-14(8-10-22)18(21)23/h1-6,11-12,14H,7-10H2,(H2,21,23) |
| InChIKey | BQELEDRTTVJANW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|