C23H27N3O2S — CID 166197529
1-[1-[(Z)-3-phenyl-2-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 166197529) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 1-[1-[(Z)-3-phenyl-2-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[1-[(Z)-3-phenyl-2-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166197529 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[1-[(Z)-3-phenyl-2-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C1CCN(C(=O)/C(=C/c2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C23H27N3O2S/c24-22(27)20-8-4-12-26(20)18-10-13-25(14-11-18)23(28)19(21-9-5-15-29-21)16-17-6-2-1-3-7-17/h1-3,5-7,9,15-16,18,20H,4,8,10-14H2,(H2,24,27)/b19-16+ |
| InChIKey | HZJFXDPKZCWBKM-KNTRCKAVSA-N |
| XLogP | 3.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|