C23H28FN3O3S2 — CID 24669731
(Z)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-en-1-one (PubChem CID 24669731) has the molecular formula C23H28FN3O3S2 and a molecular weight of 477.63 g/mol. Its IUPAC name is (Z)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (Z)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 24669731 |
| Molecular Formula | C23H28FN3O3S2 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (Z)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(F)cc1)c1cccs1)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C23H28FN3O3S2/c24-20-9-7-19(8-10-20)18-21(22-6-5-17-31-22)23(28)25-13-15-27(16-14-25)32(29,30)26-11-3-1-2-4-12-26/h5-10,17-18H,1-4,11-16H2/b21-18+ |
| InChIKey | JYOOVWWLRKZRAV-DYTRJAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|