C17H27N6O3+ — CID 74686230
2-[8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide (PubChem CID 74686230) has the molecular formula C17H27N6O3+ and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | 2-[8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 74686230 |
| Molecular Formula | C17H27N6O3+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-[8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CCC1CCCCN1CC1=[N+](CC(N)=O)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C17H26N6O3/c1-4-11-7-5-6-8-22(11)10-13-19-15-14(23(13)9-12(18)24)16(25)21(3)17(26)20(15)2/h11,14H,4-10H2,1-3H3,(H-,18,24)/p+1 |
| InChIKey | LXKDLTFXCCRYEU-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|