C19H32N5O4+ — CID 74688309
8-(azepan-1-ium-1-ylidene)-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purine-2,6-dione (PubChem CID 74688309) has the molecular formula C19H32N5O4+ and a molecular weight of 394.50 g/mol. Its IUPAC name is 8-(azepan-1-ium-1-ylidene)-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purine-2,6-dione.
| Compound Name | 8-(azepan-1-ium-1-ylidene)-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 74688309 |
| Molecular Formula | C19H32N5O4+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 8-(azepan-1-ium-1-ylidene)-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purine-2,6-dione |
| SMILES | CC(C)OCC(O)CN1C(=[N+]2CCCCCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C19H32N5O4/c1-13(2)28-12-14(25)11-24-15-16(21(3)19(27)22(4)17(15)26)20-18(24)23-9-7-5-6-8-10-23/h13-15,25H,5-12H2,1-4H3/q+1 |
| InChIKey | LQHQNVDDQRPIDJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|