C17H28N5O4+ — CID 75644869
7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 75644869) has the molecular formula C17H28N5O4+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75644869 |
| Molecular Formula | C17H28N5O4+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | CC1CCCCN1CC1=[N+](CC(O)CO)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C17H28N5O4/c1-11-6-4-5-7-21(11)9-13-18-15-14(22(13)8-12(24)10-23)16(25)20(3)17(26)19(15)2/h11-12,14,23-24H,4-10H2,1-3H3/q+1 |
| InChIKey | IWZGFMJTBNBLLE-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|