C16H26N7O4+ — CID 74572449
2-[8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide (PubChem CID 74572449) has the molecular formula C16H26N7O4+ and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | 2-[8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 74572449 |
| Molecular Formula | C16H26N7O4+ |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CN1C(=O)C2C(=NC(CN3CCN(CCO)CC3)=[N+]2CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C16H25N7O4/c1-19-14-13(15(26)20(2)16(19)27)23(9-11(17)25)12(18-14)10-22-5-3-21(4-6-22)7-8-24/h13,24H,3-10H2,1-2H3,(H-,17,25)/p+1 |
| InChIKey | BSJCOCNETNYVEA-UHFFFAOYSA-O |
| XLogP | -3.20 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|