C18H30N5O3+ — CID 74443558
8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74443558) has the molecular formula C18H30N5O3+ and a molecular weight of 364.47 g/mol. Its IUPAC name is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74443558 |
| Molecular Formula | C18H30N5O3+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC1CC(C)CN(CC2=[N+](CCCO)C3C(=O)N(C)C(=O)N(C)C3=N2)C1 |
| InChI | InChI=1S/C18H30N5O3/c1-12-8-13(2)10-22(9-12)11-14-19-16-15(23(14)6-5-7-24)17(25)21(4)18(26)20(16)3/h12-13,15,24H,5-11H2,1-4H3/q+1 |
| InChIKey | HPGAMPCQFCXROG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|