C11H15N4O4+ — CID 75609057
7-hydroxy-1,3-dimethyl-6,7,8,10-tetrahydro-4aH-purino[8,7-c][1,4]oxazepin-5-ium-2,4-dione (PubChem CID 75609057) has the molecular formula C11H15N4O4+ and a molecular weight of 267.26 g/mol. Its IUPAC name is 7-hydroxy-1,3-dimethyl-6,7,8,10-tetrahydro-4aH-purino[8,7-c][1,4]oxazepin-5-ium-2,4-dione.
| Compound Name | 7-hydroxy-1,3-dimethyl-6,7,8,10-tetrahydro-4aH-purino[8,7-c][1,4]oxazepin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 75609057 |
| Molecular Formula | C11H15N4O4+ |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 7-hydroxy-1,3-dimethyl-6,7,8,10-tetrahydro-4aH-purino[8,7-c][1,4]oxazepin-5-ium-2,4-dione |
| SMILES | CN1C(=O)C2C(=NC3=[N+]2CC(O)COC3)N(C)C1=O |
| InChI | InChI=1S/C11H15N4O4/c1-13-9-8(10(17)14(2)11(13)18)15-3-6(16)4-19-5-7(15)12-9/h6,8,16H,3-5H2,1-2H3/q+1 |
| InChIKey | CQIKWBOXLBKESW-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|