C16H27ClN5O5+ — CID 75608954
7-(2-hydroxy-3-morpholin-4-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride (PubChem CID 75608954) has the molecular formula C16H27ClN5O5+ and a molecular weight of 404.88 g/mol. Its IUPAC name is 7-(2-hydroxy-3-morpholin-4-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride.
| Compound Name | 7-(2-hydroxy-3-morpholin-4-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 75608954 |
| Molecular Formula | C16H27ClN5O5+ |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 7-(2-hydroxy-3-morpholin-4-ylpropyl)-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride |
| SMILES | COCC1=[N+](CC(O)CN2CCOCC2)C2C(=O)N(C)C(=O)N(C)C2=N1.Cl |
| InChI | InChI=1S/C16H26N5O5.ClH/c1-18-14-13(15(23)19(2)16(18)24)21(12(17-14)10-25-3)9-11(22)8-20-4-6-26-7-5-20;/h11,13,22H,4-10H2,1-3H3;1H/q+1; |
| InChIKey | WMRADVLKFZKFDQ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|