C11H18N5O4+ — CID 74806807
7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione (PubChem CID 74806807) has the molecular formula C11H18N5O4+ and a molecular weight of 284.30 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74806807 |
| Molecular Formula | C11H18N5O4+ |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)-5H-purin-7-ium-2,6-dione |
| SMILES | CNC1=[N+](CC(O)CO)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C11H17N5O4/c1-12-10-13-8-7(16(10)4-6(18)5-17)9(19)15(3)11(20)14(8)2/h6-7,17-18H,4-5H2,1-3H3/p+1 |
| InChIKey | XRVOCXJKNKCLKE-UHFFFAOYSA-O |
| XLogP | -2.77 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|