C14H24N5O5+ — CID 75608953
7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75608953) has the molecular formula C14H24N5O5+ and a molecular weight of 342.38 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608953 |
| Molecular Formula | C14H24N5O5+ |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 7-[2-hydroxy-3-(2-hydroxyethylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC1=[N+](CC(O)CNCCO)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C14H24N5O5/c1-17-12-11(13(22)18(2)14(17)23)19(10(16-12)8-24-3)7-9(21)6-15-4-5-20/h9,11,15,20-21H,4-8H2,1-3H3/q+1 |
| InChIKey | XCCVDDRTPMYPEP-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|