C15H26N5O4+ — CID 75608951
7-[2-hydroxy-3-(propan-2-ylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75608951) has the molecular formula C15H26N5O4+ and a molecular weight of 340.40 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(propan-2-ylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(propan-2-ylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608951 |
| Molecular Formula | C15H26N5O4+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 7-[2-hydroxy-3-(propan-2-ylamino)propyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC1=[N+](CC(O)CNC(C)C)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C15H26N5O4/c1-9(2)16-6-10(21)7-20-11(8-24-5)17-13-12(20)14(22)19(4)15(23)18(13)3/h9-10,12,16,21H,6-8H2,1-5H3/q+1 |
| InChIKey | BNLKDHMPEGBEKW-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|