C16H26N5O3+ — CID 78413902
8-(azepan-1-ium-1-ylidene)-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purine-2,6-dione (PubChem CID 78413902) has the molecular formula C16H26N5O3+ and a molecular weight of 336.42 g/mol. Its IUPAC name is 8-(azepan-1-ium-1-ylidene)-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purine-2,6-dione.
| Compound Name | 8-(azepan-1-ium-1-ylidene)-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78413902 |
| Molecular Formula | C16H26N5O3+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 8-(azepan-1-ium-1-ylidene)-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purine-2,6-dione |
| SMILES | CC(O)CN1C(=[N+]2CCCCCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H26N5O3/c1-11(22)10-21-12-13(18(2)16(24)19(3)14(12)23)17-15(21)20-8-6-4-5-7-9-20/h11-12,22H,4-10H2,1-3H3/q+1 |
| InChIKey | KGKSMMIBXRAHDT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|